C26H18O9 — CID 25157273
16-(2,4-dihydroxy-6-methylbenzoyl)-4,10-dihydroxy-6-methoxy-12-methyl-14-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaene-8,15-dione (PubChem CID 25157273) has the molecular formula C26H18O9 and a molecular weight of 474.42 g/mol. Its IUPAC name is 16-(2,4-dihydroxy-6-methylbenzoyl)-4,10-dihydroxy-6-methoxy-12-methyl-14-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaene-8,15-dione.
| Compound Name | 16-(2,4-dihydroxy-6-methylbenzoyl)-4,10-dihydroxy-6-methoxy-12-methyl-14-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaene-8,15-dione |
|---|---|
| PubChem CID | 25157273 |
| Molecular Formula | C26H18O9 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 16-(2,4-dihydroxy-6-methylbenzoyl)-4,10-dihydroxy-6-methoxy-12-methyl-14-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaene-8,15-dione |
| SMILES | COc1cc(O)cc2c1C(=O)c1c(O)cc(C)c3oc(=O)c(C(=O)c4c(C)cc(O)cc4O)c-2c13 |
| InChI | InChI=1S/C26H18O9/c1-9-4-11(27)7-15(30)17(9)23(31)22-19-13-6-12(28)8-16(34-3)18(13)24(32)20-14(29)5-10(2)25(21(19)20)35-26(22)33/h4-8,27-30H,1-3H3 |
| InChIKey | JZRWJIYIEFXUOK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|