About N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide
N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 25157359) has the molecular formula C22H23N5O3
and a molecular weight of 405.46 g/mol. Its IUPAC name is N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide |
| PubChem CID | 25157359 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | CCCCC(NC(=O)c1cccnc1-n1cc(-c2ccccc2)cn1)C(=O)C(N)=O |
| InChI | InChI=1S/C22H23N5O3/c1-2-3-11-18(19(28)20(23)29)26-22(30)17-10-7-12-24-21(17)27-14-16(13-25-27)15-8-5-4-6-9-15/h4-10,12-14,18H,2-3,11H2,1H3,(H2,23,29)(H,26,30) |
| InChIKey | FINKTORZTYDCIN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide?
The IUPAC name of N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide (CID 25157359) is N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide.
What is the SMILES notation for N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide?
The canonical SMILES for N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide is CCCCC(NC(=O)c1cccnc1-n1cc(-c2ccccc2)cn1)C(=O)C(N)=O.
What is the InChIKey of N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide?
The InChIKey is FINKTORZTYDCIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N5O3/c1-2-3-11-18(19(28)20(23)29)26-22(30)17-10-7-12-24-21(17)27-14-16(13-25-27)15-8-5-4-6-9-15/h4-10,12-14,18H,2-3,11H2,1H3,(H2,23,29)(H,26,30).
What are the key properties of N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide?
N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide has a molecular weight of 405.46 g/mol, XLogP of 2.28, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-1,2-dioxoheptan-3-yl)-2-(4-phenylpyrazol-1-yl)pyridine-3-carboxamide is sourced from PubChem (CID 25157359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).