About 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole
3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole (PubChem CID 25157377) has the molecular formula C18H12BrF6NO
and a molecular weight of 452.19 g/mol. Its IUPAC name is 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole |
| PubChem CID | 25157377 |
| Molecular Formula | C18H12BrF6NO |
| Molecular Weight | 452.19 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole |
| SMILES | Cc1cc(C2=NOC(c3cccc(C(F)(F)F)c3)(C(F)(F)F)C2)ccc1Br |
| InChI | InChI=1S/C18H12BrF6NO/c1-10-7-11(5-6-14(10)19)15-9-16(27-26-15,18(23,24)25)12-3-2-4-13(8-12)17(20,21)22/h2-8H,9H2,1H3 |
| InChIKey | ZCTNQBKQSLCKTB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.19 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole?
The IUPAC name of 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole (CID 25157377) is 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole.
What is the SMILES notation for 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole?
The canonical SMILES for 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole is Cc1cc(C2=NOC(c3cccc(C(F)(F)F)c3)(C(F)(F)F)C2)ccc1Br.
What is the InChIKey of 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole?
The InChIKey is ZCTNQBKQSLCKTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrF6NO/c1-10-7-11(5-6-14(10)19)15-9-16(27-26-15,18(23,24)25)12-3-2-4-13(8-12)17(20,21)22/h2-8H,9H2,1H3.
What are the key properties of 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole?
3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole has a molecular weight of 452.19 g/mol, XLogP of 6.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-3-methylphenyl)-5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazole is sourced from PubChem (CID 25157377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).