C33H40O9 — CID 25157539
1,3-bis[4-[1-(6,7,10-trioxaspiro[4.5]decan-8-yl)ethenyl]phenoxy]propan-2-ol (PubChem CID 25157539) has the molecular formula C33H40O9 and a molecular weight of 580.67 g/mol. Its IUPAC name is 1,3-bis[4-[1-(6,7,10-trioxaspiro[4.5]decan-8-yl)ethenyl]phenoxy]propan-2-ol.
| Compound Name | 1,3-bis[4-[1-(6,7,10-trioxaspiro[4.5]decan-8-yl)ethenyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 25157539 |
| Molecular Formula | C33H40O9 |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | 1,3-bis[4-[1-(6,7,10-trioxaspiro[4.5]decan-8-yl)ethenyl]phenoxy]propan-2-ol |
| SMILES | C=C(c1ccc(OCC(O)COc2ccc(C(=C)C3COC4(CCCC4)OO3)cc2)cc1)C1COC2(CCCC2)OO1 |
| InChI | InChI=1S/C33H40O9/c1-23(30-21-37-32(41-39-30)15-3-4-16-32)25-7-11-28(12-8-25)35-19-27(34)20-36-29-13-9-26(10-14-29)24(2)31-22-38-33(42-40-31)17-5-6-18-33/h7-14,27,30-31,34H,1-6,15-22H2 |
| InChIKey | RPBUJHDUJTXPIX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|