C25H22N4O2S — CID 25157661
N-(2-amino-5-thiophen-2-ylphenyl)-4-[[(2-pyridin-2-ylacetyl)amino]methyl]benzamide (PubChem CID 25157661) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[[(2-pyridin-2-ylacetyl)amino]methyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[(2-pyridin-2-ylacetyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 25157661 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[(2-pyridin-2-ylacetyl)amino]methyl]benzamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(CNC(=O)Cc2ccccn2)cc1 |
| InChI | InChI=1S/C25H22N4O2S/c26-21-11-10-19(23-5-3-13-32-23)14-22(21)29-25(31)18-8-6-17(7-9-18)16-28-24(30)15-20-4-1-2-12-27-20/h1-14H,15-16,26H2,(H,28,30)(H,29,31) |
| InChIKey | BVVSBLLOVAAAOJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|