C35H44O9 — CID 25157841
1,3-bis[4-[1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)ethenyl]phenoxy]propan-2-ol (PubChem CID 25157841) has the molecular formula C35H44O9 and a molecular weight of 608.73 g/mol. Its IUPAC name is 1,3-bis[4-[1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)ethenyl]phenoxy]propan-2-ol.
| Compound Name | 1,3-bis[4-[1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)ethenyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 25157841 |
| Molecular Formula | C35H44O9 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | 1,3-bis[4-[1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)ethenyl]phenoxy]propan-2-ol |
| SMILES | C=C(c1ccc(OCC(O)COc2ccc(C(=C)C3COC4(CCCCC4)OO3)cc2)cc1)C1COC2(CCCCC2)OO1 |
| InChI | InChI=1S/C35H44O9/c1-25(32-23-39-34(43-41-32)17-5-3-6-18-34)27-9-13-30(14-10-27)37-21-29(36)22-38-31-15-11-28(12-16-31)26(2)33-24-40-35(44-42-33)19-7-4-8-20-35/h9-16,29,32-33,36H,1-8,17-24H2 |
| InChIKey | PVRASDIDTPIMMD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|