C18H25N3 — CID 25158090
5-dec-9-enyl-3-phenyl-1H-1,2,4-triazole (PubChem CID 25158090) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is 5-dec-9-enyl-3-phenyl-1H-1,2,4-triazole.
| Compound Name | 5-dec-9-enyl-3-phenyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 25158090 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 5-dec-9-enyl-3-phenyl-1H-1,2,4-triazole |
| SMILES | C=CCCCCCCCCc1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C18H25N3/c1-2-3-4-5-6-7-8-12-15-17-19-18(21-20-17)16-13-10-9-11-14-16/h2,9-11,13-14H,1,3-8,12,15H2,(H,19,20,21) |
| InChIKey | XSQWGBYVIURZBO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|