C17H26O2 — CID 25158098
(Z)-3-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]prop-2-enoic acid (PubChem CID 25158098) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (Z)-3-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]prop-2-enoic acid.
| Compound Name | (Z)-3-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 25158098 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (Z)-3-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]prop-2-enoic acid |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1/C=C\C(=O)O |
| InChI | InChI=1S/C17H26O2/c1-12-6-8-14-16(2,3)10-5-11-17(14,4)13(12)7-9-15(18)19/h7,9,13-14H,1,5-6,8,10-11H2,2-4H3,(H,18,19)/b9-7-/t13-,14-,17+/m0/s1 |
| InChIKey | GZRHZZSARAUGHK-WFQLQYNJSA-N |
| XLogP | 4.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|