About N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide
N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide (PubChem CID 25159030) has the molecular formula C16H27N3O
and a molecular weight of 277.41 g/mol. Its IUPAC name is N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide.
Molecular Properties
| Compound Name | N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide |
| PubChem CID | 25159030 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide |
| SMILES | CCN(C)/C=N/c1ccc(OCCCC(C)C)nc1C |
| InChI | InChI=1S/C16H27N3O/c1-6-19(5)12-17-15-9-10-16(18-14(15)4)20-11-7-8-13(2)3/h9-10,12-13H,6-8,11H2,1-5H3/b17-12+ |
| InChIKey | OEAFJRUYFSQYAE-SFQUDFHCSA-N |
| XLogP | 3.82 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide?
The IUPAC name of N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide (CID 25159030) is N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide.
What is the SMILES notation for N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide?
The canonical SMILES for N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide is CCN(C)/C=N/c1ccc(OCCCC(C)C)nc1C.
What is the InChIKey of N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide?
The InChIKey is OEAFJRUYFSQYAE-SFQUDFHCSA-N. The full InChI is InChI=1S/C16H27N3O/c1-6-19(5)12-17-15-9-10-16(18-14(15)4)20-11-7-8-13(2)3/h9-10,12-13H,6-8,11H2,1-5H3/b17-12+.
What are the key properties of N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide?
N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide has a molecular weight of 277.41 g/mol, XLogP of 3.82, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-N'-[2-methyl-6-(4-methylpentoxy)-3-pyridinyl]methanimidamide is sourced from PubChem (CID 25159030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).