C24H34F4N8O3 — CID 25159112
[3-[[5-fluoro-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S,5R)-4-(3-methoxypropyl)-2,5-dimethylpiperazin-1-yl]methanone (PubChem CID 25159112) has the molecular formula C24H34F4N8O3 and a molecular weight of 558.58 g/mol. Its IUPAC name is [3-[[5-fluoro-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S,5R)-4-(3-methoxypropyl)-2,5-dimethylpiperazin-1-yl]methanone.
| Compound Name | [3-[[5-fluoro-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S,5R)-4-(3-methoxypropyl)-2,5-dimethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 25159112 |
| Molecular Formula | C24H34F4N8O3 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | [3-[[5-fluoro-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]-[(2S,5R)-4-(3-methoxypropyl)-2,5-dimethylpiperazin-1-yl]methanone |
| SMILES | COCCCN1C[C@H](C)N(C(=O)N2Cc3c(Nc4nc(OCC(F)(F)F)ncc4F)n[nH]c3C2(C)C)C[C@H]1C |
| InChI | InChI=1S/C24H34F4N8O3/c1-14-11-35(15(2)10-34(14)7-6-8-38-5)22(37)36-12-16-18(23(36,3)4)32-33-19(16)30-20-17(25)9-29-21(31-20)39-13-24(26,27)28/h9,14-15H,6-8,10-13H2,1-5H3,(H2,29,30,31,32,33)/t14-,15+/m1/s1 |
| InChIKey | HPQAVQJTTFEWSN-CABCVRRESA-N |
| XLogP | 3.63 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|