C13H28OSn2 — CID 25159140
2,4-bis(trimethylstannylmethyl)penta-1,4-dien-3-ol (PubChem CID 25159140) has the molecular formula C13H28OSn2 and a molecular weight of 437.79 g/mol. Its IUPAC name is 2,4-bis(trimethylstannylmethyl)penta-1,4-dien-3-ol.
| Compound Name | 2,4-bis(trimethylstannylmethyl)penta-1,4-dien-3-ol |
|---|---|
| PubChem CID | 25159140 |
| Molecular Formula | C13H28OSn2 |
| Molecular Weight | 437.79 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 2,4-bis(trimethylstannylmethyl)penta-1,4-dien-3-ol |
| SMILES | C=C(C[Sn](C)(C)C)C(O)C(=C)C[Sn](C)(C)C |
| InChI | InChI=1S/C7H10O.6CH3.2Sn/c1-5(2)7(8)6(3)4;;;;;;;;/h7-8H,1-4H2;6*1H3;; |
| InChIKey | QDOHEUKJIAYXBP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|