C17H32INO2 — CID 25159152
iodomethane;[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(diethylamino)acetate (PubChem CID 25159152) has the molecular formula C17H32INO2 and a molecular weight of 409.35 g/mol. Its IUPAC name is iodomethane;[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(diethylamino)acetate.
| Compound Name | iodomethane;[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(diethylamino)acetate |
|---|---|
| PubChem CID | 25159152 |
| Molecular Formula | C17H32INO2 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | iodomethane;[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 2-(diethylamino)acetate |
| SMILES | CCN(CC)CC(=O)O[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C.CI |
| InChI | InChI=1S/C16H29NO2.CH3I/c1-6-17(7-2)10-15(18)19-14-9-12-8-13(11(14)3)16(12,4)5;1-2/h11-14H,6-10H2,1-5H3;1H3/t11-,12+,13-,14-;/m1./s1 |
| InChIKey | NSXDCYPWDHHEGZ-TWPGKBSFSA-N |
| XLogP | 3.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|