C33H40O8 — CID 25159213
8-[1-[4-[3-[4-[1-(6,7,10-trioxaspiro[4.5]decan-8-yl)ethenyl]phenoxy]propoxy]phenyl]ethenyl]-6,7,10-trioxaspiro[4.5]decane (PubChem CID 25159213) has the molecular formula C33H40O8 and a molecular weight of 564.68 g/mol. Its IUPAC name is 8-[1-[4-[3-[4-[1-(6,7,10-trioxaspiro[4.5]decan-8-yl)ethenyl]phenoxy]propoxy]phenyl]ethenyl]-6,7,10-trioxaspiro[4.5]decane.
| Compound Name | 8-[1-[4-[3-[4-[1-(6,7,10-trioxaspiro[4.5]decan-8-yl)ethenyl]phenoxy]propoxy]phenyl]ethenyl]-6,7,10-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 25159213 |
| Molecular Formula | C33H40O8 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 8-[1-[4-[3-[4-[1-(6,7,10-trioxaspiro[4.5]decan-8-yl)ethenyl]phenoxy]propoxy]phenyl]ethenyl]-6,7,10-trioxaspiro[4.5]decane |
| SMILES | C=C(c1ccc(OCCCOc2ccc(C(=C)C3COC4(CCCC4)OO3)cc2)cc1)C1COC2(CCCC2)OO1 |
| InChI | InChI=1S/C33H40O8/c1-24(30-22-36-32(40-38-30)16-3-4-17-32)26-8-12-28(13-9-26)34-20-7-21-35-29-14-10-27(11-15-29)25(2)31-23-37-33(41-39-31)18-5-6-19-33/h8-15,30-31H,1-7,16-23H2 |
| InChIKey | AFWWUKGJKAHHFG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|