C35H44O8 — CID 25159215
3-[1-[4-[3-[4-[1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)ethenyl]phenoxy]propoxy]phenyl]ethenyl]-1,2,5-trioxaspiro[5.5]undecane (PubChem CID 25159215) has the molecular formula C35H44O8 and a molecular weight of 592.73 g/mol. Its IUPAC name is 3-[1-[4-[3-[4-[1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)ethenyl]phenoxy]propoxy]phenyl]ethenyl]-1,2,5-trioxaspiro[5.5]undecane.
| Compound Name | 3-[1-[4-[3-[4-[1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)ethenyl]phenoxy]propoxy]phenyl]ethenyl]-1,2,5-trioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 25159215 |
| Molecular Formula | C35H44O8 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | 3-[1-[4-[3-[4-[1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)ethenyl]phenoxy]propoxy]phenyl]ethenyl]-1,2,5-trioxaspiro[5.5]undecane |
| SMILES | C=C(c1ccc(OCCCOc2ccc(C(=C)C3COC4(CCCCC4)OO3)cc2)cc1)C1COC2(CCCCC2)OO1 |
| InChI | InChI=1S/C35H44O8/c1-26(32-24-38-34(42-40-32)18-5-3-6-19-34)28-10-14-30(15-11-28)36-22-9-23-37-31-16-12-29(13-17-31)27(2)33-25-39-35(43-41-33)20-7-4-8-21-35/h10-17,32-33H,1-9,18-25H2 |
| InChIKey | QUBOVNLOOLVJRA-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|