C28H44O5 — CID 25159231
methyl 2,2-dimethyl-5-[(9Z,12Z)-octadeca-9,12-dienoyl]-4,6-dioxocyclohexane-1-carboxylate (PubChem CID 25159231) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is methyl 2,2-dimethyl-5-[(9Z,12Z)-octadeca-9,12-dienoyl]-4,6-dioxocyclohexane-1-carboxylate.
| Compound Name | methyl 2,2-dimethyl-5-[(9Z,12Z)-octadeca-9,12-dienoyl]-4,6-dioxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 25159231 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | methyl 2,2-dimethyl-5-[(9Z,12Z)-octadeca-9,12-dienoyl]-4,6-dioxocyclohexane-1-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)C1C(=O)CC(C)(C)C(C(=O)OC)C1=O |
| InChI | InChI=1S/C28H44O5/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(29)24-23(30)21-28(2,3)25(26(24)31)27(32)33-4/h9-10,12-13,24-25H,5-8,11,14-21H2,1-4H3/b10-9-,13-12- |
| InChIKey | KVNXMIRJUHMFGK-UTJQPWESSA-N |
| XLogP | 6.34 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|