C20H22N2O3 — CID 25159518
1-(cyclopent-3-en-1-ylmethyl)-6-(3,5-dimethylbenzoyl)-5-methylpyrimidine-2,4-dione (PubChem CID 25159518) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-(cyclopent-3-en-1-ylmethyl)-6-(3,5-dimethylbenzoyl)-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-(cyclopent-3-en-1-ylmethyl)-6-(3,5-dimethylbenzoyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25159518 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-(cyclopent-3-en-1-ylmethyl)-6-(3,5-dimethylbenzoyl)-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cc(C)cc(C(=O)c2c(C)c(=O)[nH]c(=O)n2CC2CC=CC2)c1 |
| InChI | InChI=1S/C20H22N2O3/c1-12-8-13(2)10-16(9-12)18(23)17-14(3)19(24)21-20(25)22(17)11-15-6-4-5-7-15/h4-5,8-10,15H,6-7,11H2,1-3H3,(H,21,24,25) |
| InChIKey | YFWHCAZHAAOGDR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|