C22H23Cl2F3N2O3 — CID 25159845
1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-[3-propyl-5-(trifluoromethyl)-2-pyridinyl]butan-1-one (PubChem CID 25159845) has the molecular formula C22H23Cl2F3N2O3 and a molecular weight of 491.34 g/mol. Its IUPAC name is 1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-[3-propyl-5-(trifluoromethyl)-2-pyridinyl]butan-1-one.
| Compound Name | 1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-[3-propyl-5-(trifluoromethyl)-2-pyridinyl]butan-1-one |
|---|---|
| PubChem CID | 25159845 |
| Molecular Formula | C22H23Cl2F3N2O3 |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-[3-propyl-5-(trifluoromethyl)-2-pyridinyl]butan-1-one |
| SMILES | CCCc1cc(C(F)(F)F)cnc1CCCC(=O)N1CCc2c(Cl)c(O)c(O)c(Cl)c2C1 |
| InChI | InChI=1S/C22H23Cl2F3N2O3/c1-2-4-12-9-13(22(25,26)27)10-28-16(12)5-3-6-17(30)29-8-7-14-15(11-29)19(24)21(32)20(31)18(14)23/h9-10,31-32H,2-8,11H2,1H3 |
| InChIKey | XXMKURLPIYILEY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|