C25H34FN3O2 — CID 25159886
3-[[4-(2-methylpropoxy)phenyl]methyl]-1-[(2,3,5,6-tetradeuterio-4-fluorophenyl)methyl]-1-(2,2,6-trideuterio-1-methylpiperidin-4-yl)urea (PubChem CID 25159886) has the molecular formula C25H34FN3O2 and a molecular weight of 434.61 g/mol. Its IUPAC name is 3-[[4-(2-methylpropoxy)phenyl]methyl]-1-[(2,3,5,6-tetradeuterio-4-fluorophenyl)methyl]-1-(2,2,6-trideuterio-1-methylpiperidin-4-yl)urea.
| Compound Name | 3-[[4-(2-methylpropoxy)phenyl]methyl]-1-[(2,3,5,6-tetradeuterio-4-fluorophenyl)methyl]-1-(2,2,6-trideuterio-1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 25159886 |
| Molecular Formula | C25H34FN3O2 |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | 3-[[4-(2-methylpropoxy)phenyl]methyl]-1-[(2,3,5,6-tetradeuterio-4-fluorophenyl)methyl]-1-(2,2,6-trideuterio-1-methylpiperidin-4-yl)urea |
| SMILES | [2H]c1c([2H])c(CN(C(=O)NCc2ccc(OCC(C)C)cc2)C2CC([2H])N(C)C([2H])([2H])C2)c([2H])c([2H])c1F |
| InChI | InChI=1S/C25H34FN3O2/c1-19(2)18-31-24-10-6-20(7-11-24)16-27-25(30)29(23-12-14-28(3)15-13-23)17-21-4-8-22(26)9-5-21/h4-11,19,23H,12-18H2,1-3H3,(H,27,30)/i4D,5D,8D,9D,14D,15D2 |
| InChIKey | RKEWSXXUOLRFBX-CKPSHHSESA-N |
| XLogP | 4.67 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |