C22H26ClNO9 — CID 25160215
[(2R,3R,4R,5S)-3,4,5-triacetyloxy-1-[2-(4-chlorophenyl)acetyl]piperidin-2-yl]methyl acetate (PubChem CID 25160215) has the molecular formula C22H26ClNO9 and a molecular weight of 483.90 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4,5-triacetyloxy-1-[2-(4-chlorophenyl)acetyl]piperidin-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-3,4,5-triacetyloxy-1-[2-(4-chlorophenyl)acetyl]piperidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 25160215 |
| Molecular Formula | C22H26ClNO9 |
| Molecular Weight | 483.90 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-triacetyloxy-1-[2-(4-chlorophenyl)acetyl]piperidin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)CN1C(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26ClNO9/c1-12(25)30-11-18-21(32-14(3)27)22(33-15(4)28)19(31-13(2)26)10-24(18)20(29)9-16-5-7-17(23)8-6-16/h5-8,18-19,21-22H,9-11H2,1-4H3/t18-,19+,21-,22-/m1/s1 |
| InChIKey | OHXFMCRYIMZRBL-NPDDRXJXSA-N |
| XLogP | 1.45 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.90 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|