C14H18N4O — CID 25160377
2-amino-N,N-diethyl-6-methylquinazoline-4-carboxamide (PubChem CID 25160377) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-amino-N,N-diethyl-6-methylquinazoline-4-carboxamide.
| Compound Name | 2-amino-N,N-diethyl-6-methylquinazoline-4-carboxamide |
|---|---|
| PubChem CID | 25160377 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-amino-N,N-diethyl-6-methylquinazoline-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1nc(N)nc2ccc(C)cc12 |
| InChI | InChI=1S/C14H18N4O/c1-4-18(5-2)13(19)12-10-8-9(3)6-7-11(10)16-14(15)17-12/h6-8H,4-5H2,1-3H3,(H2,15,16,17) |
| InChIKey | MGAICQFFSSQKSR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |