C35H50N4O4S — CID 25160443
[(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-[[[(2R)-2-amino-3-(1H-imidazol-5-yl)propyl]amino]methyl]phenyl]sulfanylacetate (PubChem CID 25160443) has the molecular formula C35H50N4O4S and a molecular weight of 622.88 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-[[[(2R)-2-amino-3-(1H-imidazol-5-yl)propyl]amino]methyl]phenyl]sulfanylacetate.
| Compound Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-[[[(2R)-2-amino-3-(1H-imidazol-5-yl)propyl]amino]methyl]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 25160443 |
| Molecular Formula | C35H50N4O4S |
| Molecular Weight | 622.88 g/mol |
| Exact Mass | 622.36 |
| IUPAC Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-[[[(2R)-2-amino-3-(1H-imidazol-5-yl)propyl]amino]methyl]phenyl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2cccc(CNC[C@H](N)Cc3cnc[nH]3)c2)[C@]2(C)C(C)CCC3(CCC(=O)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C35H50N4O4S/c1-6-33(4)16-29(34(5)22(2)10-12-35(23(3)32(33)42)13-11-28(40)31(34)35)43-30(41)20-44-27-9-7-8-24(14-27)17-37-18-25(36)15-26-19-38-21-39-26/h6-9,14,19,21-23,25,29,31-32,37,42H,1,10-13,15-18,20,36H2,2-5H3,(H,38,39)/t22?,23-,25+,29+,31?,32-,33+,34-,35?/m0/s1 |
| InChIKey | UGDSOXIKQSSUTN-RXGCHEEDSA-N |
| XLogP | 5.07 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.88 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|