C21H40N4O4 — CID 25160458
(2S)-6-amino-2-[[(2R)-3-cyclohexyl-1-(2,2-dimethylpropylamino)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid (PubChem CID 25160458) has the molecular formula C21H40N4O4 and a molecular weight of 412.58 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2R)-3-cyclohexyl-1-(2,2-dimethylpropylamino)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2R)-3-cyclohexyl-1-(2,2-dimethylpropylamino)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 25160458 |
| Molecular Formula | C21H40N4O4 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | (2S)-6-amino-2-[[(2R)-3-cyclohexyl-1-(2,2-dimethylpropylamino)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid |
| SMILES | CC(C)(C)CNC(=O)[C@@H](CC1CCCCC1)NC(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C21H40N4O4/c1-21(2,3)14-23-18(26)17(13-15-9-5-4-6-10-15)25-20(29)24-16(19(27)28)11-7-8-12-22/h15-17H,4-14,22H2,1-3H3,(H,23,26)(H,27,28)(H2,24,25,29)/t16-,17+/m0/s1 |
| InChIKey | XWDGSLJVTQYSEC-DLBZAZTESA-N |
| XLogP | 2.37 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|