About 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide
1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide (PubChem CID 25160740) has the molecular formula C26H24F2N2O2
and a molecular weight of 434.49 g/mol. Its IUPAC name is 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide.
Molecular Properties
| Compound Name | 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide |
| PubChem CID | 25160740 |
| Molecular Formula | C26H24F2N2O2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide |
| SMILES | CC(C)c1c(C(=O)NCc2ccc(F)c(F)c2)c2ccc(O)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C26H24F2N2O2/c1-16(2)25-24(26(32)29-14-18-8-11-21(27)22(28)12-18)20-10-9-19(31)13-23(20)30(25)15-17-6-4-3-5-7-17/h3-13,16,31H,14-15H2,1-2H3,(H,29,32) |
| InChIKey | NCHGPLXPTROIAW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide?
The IUPAC name of 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide (CID 25160740) is 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide.
What is the SMILES notation for 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide?
The canonical SMILES for 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide is CC(C)c1c(C(=O)NCc2ccc(F)c(F)c2)c2ccc(O)cc2n1Cc1ccccc1.
What is the InChIKey of 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide?
The InChIKey is NCHGPLXPTROIAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24F2N2O2/c1-16(2)25-24(26(32)29-14-18-8-11-21(27)22(28)12-18)20-10-9-19(31)13-23(20)30(25)15-17-6-4-3-5-7-17/h3-13,16,31H,14-15H2,1-2H3,(H,29,32).
What are the key properties of 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide?
1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide has a molecular weight of 434.49 g/mol, XLogP of 5.73, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-N-[(3,4-difluorophenyl)methyl]-6-hydroxy-2-propan-2-ylindole-3-carboxamide is sourced from PubChem (CID 25160740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).