C28H38O6 — CID 25160785
[(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-hydroxyphenoxy)acetate (PubChem CID 25160785) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-hydroxyphenoxy)acetate.
| Compound Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-hydroxyphenoxy)acetate |
|---|---|
| PubChem CID | 25160785 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(4-hydroxyphenoxy)acetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)COc2ccc(O)cc2)[C@]2(C)C(C)CCC3(CCC(=O)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C28H38O6/c1-6-26(4)15-22(34-23(31)16-33-20-9-7-19(29)8-10-20)27(5)17(2)11-13-28(18(3)25(26)32)14-12-21(30)24(27)28/h6-10,17-18,22,24-25,29,32H,1,11-16H2,2-5H3/t17?,18-,22+,24?,25-,26+,27-,28?/m0/s1 |
| InChIKey | MGKCTRUKXMALDV-RYZCGXKMSA-N |
| XLogP | 4.68 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|