C16H25N3O — CID 25161459
5-(2-methylbutan-2-yl)-N-prop-2-enyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 25161459) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 5-(2-methylbutan-2-yl)-N-prop-2-enyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | 5-(2-methylbutan-2-yl)-N-prop-2-enyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 25161459 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 5-(2-methylbutan-2-yl)-N-prop-2-enyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | C=CCNC(=O)c1n[nH]c2c1CC(C(C)(C)CC)CC2 |
| InChI | InChI=1S/C16H25N3O/c1-5-9-17-15(20)14-12-10-11(16(3,4)6-2)7-8-13(12)18-19-14/h5,11H,1,6-10H2,2-4H3,(H,17,20)(H,18,19) |
| InChIKey | JAAJNHVROLXXSD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|