C14H22N4O — CID 25161469
5-cyclohexyl-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide (PubChem CID 25161469) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 5-cyclohexyl-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide.
| Compound Name | 5-cyclohexyl-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide |
|---|---|
| PubChem CID | 25161469 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 5-cyclohexyl-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide |
| SMILES | NNC(=O)c1n[nH]c2c1CC(C1CCCCC1)CC2 |
| InChI | InChI=1S/C14H22N4O/c15-16-14(19)13-11-8-10(6-7-12(11)17-18-13)9-4-2-1-3-5-9/h9-10H,1-8,15H2,(H,16,19)(H,17,18) |
| InChIKey | LOHQDTIZANEYAN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|