About 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide
2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide (PubChem CID 25161575) has the molecular formula C22H28N2O3
and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide |
| PubChem CID | 25161575 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)C(=O)COc1c(C)cccc1C |
| InChI | InChI=1S/C22H28N2O3/c1-5-13-24(14-20(25)23-19-12-7-6-9-16(19)2)21(26)15-27-22-17(3)10-8-11-18(22)4/h6-12H,5,13-15H2,1-4H3,(H,23,25) |
| InChIKey | ZRCREFSFTRADQK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide?
The IUPAC name of 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide (CID 25161575) is 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide.
What is the SMILES notation for 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide?
The canonical SMILES for 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide is CCCN(CC(=O)Nc1ccccc1C)C(=O)COc1c(C)cccc1C.
What is the InChIKey of 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide?
The InChIKey is ZRCREFSFTRADQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O3/c1-5-13-24(14-20(25)23-19-12-7-6-9-16(19)2)21(26)15-27-22-17(3)10-8-11-18(22)4/h6-12H,5,13-15H2,1-4H3,(H,23,25).
What are the key properties of 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide?
2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide has a molecular weight of 368.48 g/mol, XLogP of 3.87, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2,6-dimethylphenoxy)acetyl]-propylamino]-N-(2-methylphenyl)acetamide is sourced from PubChem (CID 25161575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).