About N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide
N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide (PubChem CID 25161607) has the molecular formula C20H18FN3O4
and a molecular weight of 383.38 g/mol. Its IUPAC name is N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide.
Molecular Properties
| Compound Name | N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide |
| PubChem CID | 25161607 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide |
| SMILES | Cc1noc(C)c1COc1ccc(C(=O)NNC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C20H18FN3O4/c1-12-17(13(2)28-24-12)11-27-15-9-7-14(8-10-15)19(25)22-23-20(26)16-5-3-4-6-18(16)21/h3-10H,11H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | VVECHMIUGWBDAH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide?
The IUPAC name of N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide (CID 25161607) is N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide.
What is the SMILES notation for N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide?
The canonical SMILES for N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide is Cc1noc(C)c1COc1ccc(C(=O)NNC(=O)c2ccccc2F)cc1.
What is the InChIKey of N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide?
The InChIKey is VVECHMIUGWBDAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18FN3O4/c1-12-17(13(2)28-24-12)11-27-15-9-7-14(8-10-15)19(25)22-23-20(26)16-5-3-4-6-18(16)21/h3-10H,11H2,1-2H3,(H,22,25)(H,23,26).
What are the key properties of N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide?
N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide has a molecular weight of 383.38 g/mol, XLogP of 3.08, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-fluorobenzohydrazide is sourced from PubChem (CID 25161607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).