About 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole
1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole (PubChem CID 25161741) has the molecular formula C17H15N3O
and a molecular weight of 277.33 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole |
| PubChem CID | 25161741 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole |
| SMILES | COc1ccc(C2=NCCn3nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C17H15N3O/c1-21-13-8-6-12(7-9-13)16-17-14-4-2-3-5-15(14)19-20(17)11-10-18-16/h2-9H,10-11H2,1H3 |
| InChIKey | GMPCCHYBGCHTCN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole?
The IUPAC name of 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole (CID 25161741) is 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole.
What is the SMILES notation for 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole?
The canonical SMILES for 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole is COc1ccc(C2=NCCn3nc4ccccc4c32)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole?
The InChIKey is GMPCCHYBGCHTCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O/c1-21-13-8-6-12(7-9-13)16-17-14-4-2-3-5-15(14)19-20(17)11-10-18-16/h2-9H,10-11H2,1H3.
What are the key properties of 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole?
1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole has a molecular weight of 277.33 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-3,4-dihydropyrazino[1,2-b]indazole is sourced from PubChem (CID 25161741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).