C19H22Cl2N4O5S — CID 25161811
3-[2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 25161811) has the molecular formula C19H22Cl2N4O5S and a molecular weight of 489.38 g/mol. Its IUPAC name is 3-[2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 25161811 |
| Molecular Formula | C19H22Cl2N4O5S |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 3-[2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C(CN1C(=O)NC2(CCCC2)C1=O)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C19H22Cl2N4O5S/c20-13-3-4-14(21)15(11-13)31(29,30)24-9-7-23(8-10-24)16(26)12-25-17(27)19(22-18(25)28)5-1-2-6-19/h3-4,11H,1-2,5-10,12H2,(H,22,28) |
| InChIKey | OQWFLRCCKYEEAZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|