C22H28N2O3 — CID 25161930
ethyl 1-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)piperidine-3-carboxylate (PubChem CID 25161930) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is ethyl 1-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 25161930 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | ethyl 1-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccc3[nH]c4c(c3c2)CC(C)CC4)C1 |
| InChI | InChI=1S/C22H28N2O3/c1-3-27-22(26)16-5-4-10-24(13-16)21(25)15-7-9-20-18(12-15)17-11-14(2)6-8-19(17)23-20/h7,9,12,14,16,23H,3-6,8,10-11,13H2,1-2H3 |
| InChIKey | QNKQEPLAGJAFKE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|