About 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide
2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 25161959) has the molecular formula C18H25ClN2O3S
and a molecular weight of 384.93 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| PubChem CID | 25161959 |
| Molecular Formula | C18H25ClN2O3S |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccccc1Cl)C(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C18H25ClN2O3S/c1-12-10-21(11-13(2)24-12)18(23)16(8-9-25-3)20-17(22)14-6-4-5-7-15(14)19/h4-7,12-13,16H,8-11H2,1-3H3,(H,20,22) |
| InChIKey | JYQRAOVQVWWAHK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide?
The IUPAC name of 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (CID 25161959) is 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
What is the SMILES notation for 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide?
The canonical SMILES for 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide is CSCCC(NC(=O)c1ccccc1Cl)C(=O)N1CC(C)OC(C)C1.
What is the InChIKey of 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide?
The InChIKey is JYQRAOVQVWWAHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25ClN2O3S/c1-12-10-21(11-13(2)24-12)18(23)16(8-9-25-3)20-17(22)14-6-4-5-7-15(14)19/h4-7,12-13,16H,8-11H2,1-3H3,(H,20,22).
What are the key properties of 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide?
2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide has a molecular weight of 384.93 g/mol, XLogP of 2.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide is sourced from PubChem (CID 25161959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).