C24H23N5O5 — CID 25162007
N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 25162007) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 25162007 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)c2ccccc2OCc2c(C)noc2C)c2ccccc2c1=O |
| InChI | InChI=1S/C24H23N5O5/c1-4-29-24(32)17-10-6-5-9-16(17)21(27-29)23(31)26-25-22(30)18-11-7-8-12-20(18)33-13-19-14(2)28-34-15(19)3/h5-12H,4,13H2,1-3H3,(H,25,30)(H,26,31) |
| InChIKey | UPHUZOARYADCLJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|