C24H28ClN3O4 — CID 25162102
1-(4-chlorobenzoyl)-N-ethyl-N-[2-(4-methoxyanilino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 25162102) has the molecular formula C24H28ClN3O4 and a molecular weight of 457.96 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-ethyl-N-[2-(4-methoxyanilino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-ethyl-N-[2-(4-methoxyanilino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25162102 |
| Molecular Formula | C24H28ClN3O4 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-ethyl-N-[2-(4-methoxyanilino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | CCN(CC(=O)Nc1ccc(OC)cc1)C(=O)C1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H28ClN3O4/c1-3-27(16-22(29)26-20-8-10-21(32-2)11-9-20)23(30)18-12-14-28(15-13-18)24(31)17-4-6-19(25)7-5-17/h4-11,18H,3,12-16H2,1-2H3,(H,26,29) |
| InChIKey | RLAPBVAZKXTQGW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |