C24H30N2O5 — CID 25162135
[2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoate (PubChem CID 25162135) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoate.
| Compound Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 25162135 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoate |
| SMILES | CC(C)(C)N(Cc1ccccc1)C(=O)COC(=O)CCN1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C24H30N2O5/c1-24(2,3)26(15-17-9-5-4-6-10-17)20(27)16-31-21(28)13-14-25-22(29)18-11-7-8-12-19(18)23(25)30/h4-10,18-19H,11-16H2,1-3H3 |
| InChIKey | BXHUUGIKQBUDNP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|