C27H33N3O4 — CID 25162291
5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 25162291) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 25162291 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CCOc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C27H33N3O4/c1-6-34-22-12-11-17(16-30-24(32)19-9-7-8-10-20(19)25(30)33)13-21(22)23(31)28-18-14-26(2,3)29-27(4,5)15-18/h7-13,18,29H,6,14-16H2,1-5H3,(H,28,31) |
| InChIKey | FUOWZLTUFYRRAZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|