About N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide
N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide (PubChem CID 25162423) has the molecular formula C17H22N4O2
and a molecular weight of 314.39 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide.
Molecular Properties
| Compound Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide |
| PubChem CID | 25162423 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)CC(C)c2ccccc2)n1 |
| InChI | InChI=1S/C17H22N4O2/c1-12(15-7-5-4-6-8-15)9-16(22)18-19-17(23)11-21-14(3)10-13(2)20-21/h4-8,10,12H,9,11H2,1-3H3,(H,18,22)(H,19,23) |
| InChIKey | XWEXAJWGJHLOHK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide?
The IUPAC name of N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide (CID 25162423) is N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide.
What is the SMILES notation for N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide?
The canonical SMILES for N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide is Cc1cc(C)n(CC(=O)NNC(=O)CC(C)c2ccccc2)n1.
What is the InChIKey of N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide?
The InChIKey is XWEXAJWGJHLOHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2/c1-12(15-7-5-4-6-8-15)9-16(22)18-19-17(23)11-21-14(3)10-13(2)20-21/h4-8,10,12H,9,11H2,1-3H3,(H,18,22)(H,19,23).
What are the key properties of N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide?
N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide has a molecular weight of 314.39 g/mol, XLogP of 1.84, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-phenylbutanehydrazide is sourced from PubChem (CID 25162423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).