About N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide
N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 25162470) has the molecular formula C19H27N3O3S2
and a molecular weight of 409.58 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide.
Molecular Properties
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide |
| PubChem CID | 25162470 |
| Molecular Formula | C19H27N3O3S2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | CCCCN(C(=O)CSc1nc2ccccc2n1CC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H27N3O3S2/c1-3-5-11-22(15-10-12-27(24,25)14-15)18(23)13-26-19-20-16-8-6-7-9-17(16)21(19)4-2/h6-9,15H,3-5,10-14H2,1-2H3 |
| InChIKey | KXUWUNJGGCCKJR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide?
The IUPAC name of N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide (CID 25162470) is N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide.
What is the SMILES notation for N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide?
The canonical SMILES for N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide is CCCCN(C(=O)CSc1nc2ccccc2n1CC)C1CCS(=O)(=O)C1.
What is the InChIKey of N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide?
The InChIKey is KXUWUNJGGCCKJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O3S2/c1-3-5-11-22(15-10-12-27(24,25)14-15)18(23)13-26-19-20-16-8-6-7-9-17(16)21(19)4-2/h6-9,15H,3-5,10-14H2,1-2H3.
What are the key properties of N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide?
N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide has a molecular weight of 409.58 g/mol, XLogP of 2.96, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(1-ethylbenzimidazol-2-yl)sulfanylacetamide is sourced from PubChem (CID 25162470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).