About [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate
[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate (PubChem CID 25162518) has the molecular formula C21H23NO6S
and a molecular weight of 417.48 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate |
| PubChem CID | 25162518 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate |
| SMILES | O=C(COc1ccccc1)OCC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H23NO6S/c23-20(15-28-21(24)16-27-18-7-3-1-4-8-18)17-9-11-19(12-10-17)29(25,26)22-13-5-2-6-14-22/h1,3-4,7-12H,2,5-6,13-16H2 |
| InChIKey | FZFSDNBQRRVMFW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate?
The IUPAC name of [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate (CID 25162518) is [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate.
What is the SMILES notation for [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate?
The canonical SMILES for [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate is O=C(COc1ccccc1)OCC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1.
What is the InChIKey of [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate?
The InChIKey is FZFSDNBQRRVMFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO6S/c23-20(15-28-21(24)16-27-18-7-3-1-4-8-18)17-9-11-19(12-10-17)29(25,26)22-13-5-2-6-14-22/h1,3-4,7-12H,2,5-6,13-16H2.
What are the key properties of [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate?
[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate has a molecular weight of 417.48 g/mol, XLogP of 2.67, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2-phenoxyacetate is sourced from PubChem (CID 25162518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).