C19H22N2O2S — CID 25162543
(E)-N-ethyl-3-(4-methylphenyl)-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]prop-2-enamide (PubChem CID 25162543) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is (E)-N-ethyl-3-(4-methylphenyl)-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-N-ethyl-3-(4-methylphenyl)-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 25162543 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (E)-N-ethyl-3-(4-methylphenyl)-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]prop-2-enamide |
| SMILES | CCN(CC(=O)NCc1cccs1)C(=O)/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22N2O2S/c1-3-21(14-18(22)20-13-17-5-4-12-24-17)19(23)11-10-16-8-6-15(2)7-9-16/h4-12H,3,13-14H2,1-2H3,(H,20,22)/b11-10+ |
| InChIKey | BUIHIVKUAQKVIP-ZHACJKMWSA-N |
| XLogP | 3.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|