C21H27F3N2O3S — CID 25162779
N-[2-(cyclohexen-1-yl)ethyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 25162779) has the molecular formula C21H27F3N2O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 25162779 |
| Molecular Formula | C21H27F3N2O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H27F3N2O3S/c22-21(23,24)18-7-4-8-19(15-18)30(28,29)26-13-10-17(11-14-26)20(27)25-12-9-16-5-2-1-3-6-16/h4-5,7-8,15,17H,1-3,6,9-14H2,(H,25,27) |
| InChIKey | DJIYREXLAKZMJH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|