About (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide
(3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide (PubChem CID 25163024) has the molecular formula C13H22N8O3
and a molecular weight of 338.37 g/mol. Its IUPAC name is (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide.
Molecular Properties
| Compound Name | (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide |
| PubChem CID | 25163024 |
| Molecular Formula | C13H22N8O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide |
| SMILES | NC(=O)C[C@H](N)c1cn([C@@H](CC(N)=O)C(=O)N2CCNCC2)nn1 |
| InChI | InChI=1S/C13H22N8O3/c14-8(5-11(15)22)9-7-21(19-18-9)10(6-12(16)23)13(24)20-3-1-17-2-4-20/h7-8,10,17H,1-6,14H2,(H2,15,22)(H2,16,23)/t8-,10-/m0/s1 |
| InChIKey | MLWYGKCXAMFMTO-WPRPVWTQSA-N |
| XLogP | -3.00 |
| TPSA | 175.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide?
The IUPAC name of (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide (CID 25163024) is (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide.
What is the SMILES notation for (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide?
The canonical SMILES for (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide is NC(=O)C[C@H](N)c1cn([C@@H](CC(N)=O)C(=O)N2CCNCC2)nn1.
What is the InChIKey of (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide?
The InChIKey is MLWYGKCXAMFMTO-WPRPVWTQSA-N. The full InChI is InChI=1S/C13H22N8O3/c14-8(5-11(15)22)9-7-21(19-18-9)10(6-12(16)23)13(24)20-3-1-17-2-4-20/h7-8,10,17H,1-6,14H2,(H2,15,22)(H2,16,23)/t8-,10-/m0/s1.
What are the key properties of (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide?
(3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide has a molecular weight of 338.37 g/mol, XLogP of -3.00, 7 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[4-[(1S)-1,3-diamino-3-oxopropyl]triazol-1-yl]-4-oxo-4-piperazin-1-ylbutanamide is sourced from PubChem (CID 25163024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).