C21H24N2O5 — CID 25163099
[2-[benzyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoate (PubChem CID 25163099) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is [2-[benzyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoate.
| Compound Name | [2-[benzyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 25163099 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | [2-[benzyl(methyl)amino]-2-oxoethyl] 3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoate |
| SMILES | CN(Cc1ccccc1)C(=O)COC(=O)CCN1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C21H24N2O5/c1-22(13-15-7-3-2-4-8-15)18(24)14-28-19(25)11-12-23-20(26)16-9-5-6-10-17(16)21(23)27/h2-8,16-17H,9-14H2,1H3 |
| InChIKey | UWELKBNGVRIJQI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|