C11H9F3N4O3 — CID 25163116
N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]furan-2-carbohydrazide (PubChem CID 25163116) has the molecular formula C11H9F3N4O3 and a molecular weight of 302.21 g/mol. Its IUPAC name is N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 25163116 |
| Molecular Formula | C11H9F3N4O3 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]furan-2-carbohydrazide |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C11H9F3N4O3/c12-11(13,14)8-3-4-18(17-8)6-9(19)15-16-10(20)7-2-1-5-21-7/h1-5H,6H2,(H,15,19)(H,16,20) |
| InChIKey | IANUZKFCIHHMKX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|