About [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate
[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate (PubChem CID 25163149) has the molecular formula C24H30N2O6S
and a molecular weight of 474.58 g/mol. Its IUPAC name is [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate.
Molecular Properties
| Compound Name | [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate |
| PubChem CID | 25163149 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)COC(=O)CCOc3ccccc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C24H30N2O6S/c1-18-8-9-22(20(3)16-18)33(29,30)26-13-11-25(12-14-26)23(27)17-32-24(28)10-15-31-21-7-5-4-6-19(21)2/h4-9,16H,10-15,17H2,1-3H3 |
| InChIKey | WMSVGIPPCFCSMS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate?
The IUPAC name of [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate (CID 25163149) is [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate.
What is the SMILES notation for [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate?
The canonical SMILES for [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate is Cc1ccc(S(=O)(=O)N2CCN(C(=O)COC(=O)CCOc3ccccc3C)CC2)c(C)c1.
What is the InChIKey of [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate?
The InChIKey is WMSVGIPPCFCSMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O6S/c1-18-8-9-22(20(3)16-18)33(29,30)26-13-11-25(12-14-26)23(27)17-32-24(28)10-15-31-21-7-5-4-6-19(21)2/h4-9,16H,10-15,17H2,1-3H3.
What are the key properties of [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate?
[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate has a molecular weight of 474.58 g/mol, XLogP of 2.46, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(2-methylphenoxy)propanoate is sourced from PubChem (CID 25163149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).