About [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate
[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate (PubChem CID 25163150) has the molecular formula C23H28N2O6S
and a molecular weight of 460.55 g/mol. Its IUPAC name is [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate.
Molecular Properties
| Compound Name | [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate |
| PubChem CID | 25163150 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)COC(=O)CCOc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C23H28N2O6S/c1-18-8-9-21(19(2)16-18)32(28,29)25-13-11-24(12-14-25)22(26)17-31-23(27)10-15-30-20-6-4-3-5-7-20/h3-9,16H,10-15,17H2,1-2H3 |
| InChIKey | YGQABSILBLVLSR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate?
The IUPAC name of [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate (CID 25163150) is [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate.
What is the SMILES notation for [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate?
The canonical SMILES for [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate is Cc1ccc(S(=O)(=O)N2CCN(C(=O)COC(=O)CCOc3ccccc3)CC2)c(C)c1.
What is the InChIKey of [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate?
The InChIKey is YGQABSILBLVLSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O6S/c1-18-8-9-21(19(2)16-18)32(28,29)25-13-11-24(12-14-25)22(26)17-31-23(27)10-15-30-20-6-4-3-5-7-20/h3-9,16H,10-15,17H2,1-2H3.
What are the key properties of [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate?
[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate has a molecular weight of 460.55 g/mol, XLogP of 2.15, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-phenoxypropanoate is sourced from PubChem (CID 25163150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).