C20H21BrN4O5S — CID 25163191
3-(4-acetylpiperazin-1-yl)sulfonyl-N'-(4-bromobenzoyl)benzohydrazide (PubChem CID 25163191) has the molecular formula C20H21BrN4O5S and a molecular weight of 509.38 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)sulfonyl-N'-(4-bromobenzoyl)benzohydrazide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N'-(4-bromobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 25163191 |
| Molecular Formula | C20H21BrN4O5S |
| Molecular Weight | 509.38 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N'-(4-bromobenzoyl)benzohydrazide |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)NNC(=O)c3ccc(Br)cc3)c2)CC1 |
| InChI | InChI=1S/C20H21BrN4O5S/c1-14(26)24-9-11-25(12-10-24)31(29,30)18-4-2-3-16(13-18)20(28)23-22-19(27)15-5-7-17(21)8-6-15/h2-8,13H,9-12H2,1H3,(H,22,27)(H,23,28) |
| InChIKey | VCMRLOBRKLSKBA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|