C18H22BrN3O3S — CID 25163280
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 25163280) has the molecular formula C18H22BrN3O3S and a molecular weight of 440.36 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 25163280 |
| Molecular Formula | C18H22BrN3O3S |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C(=O)C1CSC2(C)CCC(=O)N12 |
| InChI | InChI=1S/C18H22BrN3O3S/c1-11-8-12(19)4-5-13(11)20-15(23)9-21(3)17(25)14-10-26-18(2)7-6-16(24)22(14)18/h4-5,8,14H,6-7,9-10H2,1-3H3,(H,20,23) |
| InChIKey | VEPVWMPUJNXJST-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |