C18H24N4O5S — CID 25163286
2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[1-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 25163286) has the molecular formula C18H24N4O5S and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[1-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[1-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 25163286 |
| Molecular Formula | C18H24N4O5S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[1-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CN1C(=O)NC2(CCCCC2)C1=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H24N4O5S/c1-12(13-5-7-14(8-6-13)28(19,26)27)20-15(23)11-22-16(24)18(21-17(22)25)9-3-2-4-10-18/h5-8,12H,2-4,9-11H2,1H3,(H,20,23)(H,21,25)(H2,19,26,27) |
| InChIKey | MAIZFNIZGVSGCZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|