C26H27ClN4O4S — CID 25163401
N-[2-(2-chloroanilino)-2-oxoethyl]-N-methyl-3-(4-phenylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 25163401) has the molecular formula C26H27ClN4O4S and a molecular weight of 527.05 g/mol. Its IUPAC name is N-[2-(2-chloroanilino)-2-oxoethyl]-N-methyl-3-(4-phenylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[2-(2-chloroanilino)-2-oxoethyl]-N-methyl-3-(4-phenylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 25163401 |
| Molecular Formula | C26H27ClN4O4S |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | N-[2-(2-chloroanilino)-2-oxoethyl]-N-methyl-3-(4-phenylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)c1cccc(S(=O)(=O)N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H27ClN4O4S/c1-29(19-25(32)28-24-13-6-5-12-23(24)27)26(33)20-8-7-11-22(18-20)36(34,35)31-16-14-30(15-17-31)21-9-3-2-4-10-21/h2-13,18H,14-17,19H2,1H3,(H,28,32) |
| InChIKey | UNNFDVCBAOASHC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |